C10H12ClN3O2S — CID 170994458
5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile;hydrochloride (PubChem CID 170994458) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile;hydrochloride.
| Compound Name | 5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 170994458 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile;hydrochloride |
| SMILES | CN1CC(S(=O)(=O)c2ccc(C#N)nc2)C1.Cl |
| InChI | InChI=1S/C10H11N3O2S.ClH/c1-13-6-10(7-13)16(14,15)9-3-2-8(4-11)12-5-9;/h2-3,5,10H,6-7H2,1H3;1H |
| InChIKey | WCOQEWUFMDXXNI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |