C19H26BrNO5 — CID 174050283
tert-butyl 3-[4-(3-bromooxan-4-yl)oxyphenoxy]azetidine-1-carboxylate (PubChem CID 174050283) has the molecular formula C19H26BrNO5 and a molecular weight of 428.32 g/mol. Its IUPAC name is tert-butyl 3-[4-(3-bromooxan-4-yl)oxyphenoxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(3-bromooxan-4-yl)oxyphenoxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 174050283 |
| Molecular Formula | C19H26BrNO5 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | tert-butyl 3-[4-(3-bromooxan-4-yl)oxyphenoxy]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc(OC3CCOCC3Br)cc2)C1 |
| InChI | InChI=1S/C19H26BrNO5/c1-19(2,3)26-18(22)21-10-15(11-21)24-13-4-6-14(7-5-13)25-17-8-9-23-12-16(17)20/h4-7,15-17H,8-12H2,1-3H3 |
| InChIKey | JQAJAWCZAYMIEH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|