C19H28N2O3Si — CID 175987200
tert-butyl (3R)-3-[[4-(2-trimethylsilylethynyl)-3-pyridinyl]oxy]pyrrolidine-1-carboxylate (PubChem CID 175987200) has the molecular formula C19H28N2O3Si and a molecular weight of 360.53 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[4-(2-trimethylsilylethynyl)-3-pyridinyl]oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[4-(2-trimethylsilylethynyl)-3-pyridinyl]oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175987200 |
| Molecular Formula | C19H28N2O3Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | tert-butyl (3R)-3-[[4-(2-trimethylsilylethynyl)-3-pyridinyl]oxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Oc2cnccc2C#C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C19H28N2O3Si/c1-19(2,3)24-18(22)21-11-8-16(14-21)23-17-13-20-10-7-15(17)9-12-25(4,5)6/h7,10,13,16H,8,11,14H2,1-6H3/t16-/m1/s1 |
| InChIKey | PCQQOJFQRLPXHW-MRXNPFEDSA-N |
| XLogP | 3.70 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|