C11H11N3O3 — CID 139331666
3-[(4-cyano-3-pyridinyl)oxy]pyrrolidine-1-carboxylic acid (PubChem CID 139331666) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-[(4-cyano-3-pyridinyl)oxy]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[(4-cyano-3-pyridinyl)oxy]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 139331666 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-[(4-cyano-3-pyridinyl)oxy]pyrrolidine-1-carboxylic acid |
| SMILES | N#Cc1ccncc1OC1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C11H11N3O3/c12-5-8-1-3-13-6-10(8)17-9-2-4-14(7-9)11(15)16/h1,3,6,9H,2,4,7H2,(H,15,16) |
| InChIKey | JMFPVXPBUSXZEX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |