C14H18N2O — CID 113269473
3-(3,5-dimethylcyclohexyl)oxypyridine-4-carbonitrile (PubChem CID 113269473) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(3,5-dimethylcyclohexyl)oxypyridine-4-carbonitrile.
| Compound Name | 3-(3,5-dimethylcyclohexyl)oxypyridine-4-carbonitrile |
|---|---|
| PubChem CID | 113269473 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-(3,5-dimethylcyclohexyl)oxypyridine-4-carbonitrile |
| SMILES | CC1CC(C)CC(Oc2cnccc2C#N)C1 |
| InChI | InChI=1S/C14H18N2O/c1-10-5-11(2)7-13(6-10)17-14-9-16-4-3-12(14)8-15/h3-4,9-11,13H,5-7H2,1-2H3 |
| InChIKey | UUPCDHSXQMWKER-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |