C24H26N2O3 — CID 175367131
tert-butyl 3-isoquinolin-5-yloxy-4-phenylpyrrolidine-1-carboxylate (PubChem CID 175367131) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl 3-isoquinolin-5-yloxy-4-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-isoquinolin-5-yloxy-4-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175367131 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | tert-butyl 3-isoquinolin-5-yloxy-4-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2cccc3cnccc23)C(c2ccccc2)C1 |
| InChI | InChI=1S/C24H26N2O3/c1-24(2,3)29-23(27)26-15-20(17-8-5-4-6-9-17)22(16-26)28-21-11-7-10-18-14-25-13-12-19(18)21/h4-14,20,22H,15-16H2,1-3H3 |
| InChIKey | YKMPKPLRRJFSJV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |