C12H12N2O3 — CID 90006100
4-[(1S,5S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-en-3-yl]-3-nitropyridine (PubChem CID 90006100) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 4-[(1S,5S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-en-3-yl]-3-nitropyridine.
| Compound Name | 4-[(1S,5S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-en-3-yl]-3-nitropyridine |
|---|---|
| PubChem CID | 90006100 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-[(1S,5S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-en-3-yl]-3-nitropyridine |
| SMILES | C[C@H]1CC(c2ccncc2[N+](=O)[O-])=C[C@@H]2OC21 |
| InChI | InChI=1S/C12H12N2O3/c1-7-4-8(5-11-12(7)17-11)9-2-3-13-6-10(9)14(15)16/h2-3,5-7,11-12H,4H2,1H3/t7-,11-,12?/m0/s1 |
| InChIKey | BFLJMYUTOXETPQ-KBCWANFGSA-N |
| XLogP | 2.18 |
| TPSA | 68.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|