C12H14N2O4 — CID 67208262
(2R,3R,6R)-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxan-4-one (PubChem CID 67208262) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2R,3R,6R)-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxan-4-one.
| Compound Name | (2R,3R,6R)-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxan-4-one |
|---|---|
| PubChem CID | 67208262 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2R,3R,6R)-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxan-4-one |
| SMILES | C[C@H]1O[C@@H](c2ccncc2[N+](=O)[O-])CC(=O)[C@@H]1C |
| InChI | InChI=1S/C12H14N2O4/c1-7-8(2)18-12(5-11(7)15)9-3-4-13-6-10(9)14(16)17/h3-4,6-8,12H,5H2,1-2H3/t7-,8-,12-/m1/s1 |
| InChIKey | SUVSELFSHADBRK-DNSOKLHBSA-N |
| XLogP | 2.04 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|