C19H28N2O4Si — CID 66652518
triethyl-[[(5R)-8-methyl-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]oct-7-en-7-yl]oxy]silane (PubChem CID 66652518) has the molecular formula C19H28N2O4Si and a molecular weight of 376.53 g/mol. Its IUPAC name is triethyl-[[(5R)-8-methyl-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]oct-7-en-7-yl]oxy]silane.
| Compound Name | triethyl-[[(5R)-8-methyl-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]oct-7-en-7-yl]oxy]silane |
|---|---|
| PubChem CID | 66652518 |
| Molecular Formula | C19H28N2O4Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | triethyl-[[(5R)-8-methyl-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]oct-7-en-7-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)OC1=C(C)C2(CC2)O[C@@H](c2ccncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H28N2O4Si/c1-5-26(6-2,7-3)25-17-12-18(24-19(9-10-19)14(17)4)15-8-11-20-13-16(15)21(22)23/h8,11,13,18H,5-7,9-10,12H2,1-4H3/t18-/m1/s1 |
| InChIKey | RVDIGGPTBIRBCN-GOSISDBHSA-N |
| XLogP | 5.28 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|