C14H16N2O5 — CID 66652626
[5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate (PubChem CID 66652626) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is [5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate.
| Compound Name | [5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate |
|---|---|
| PubChem CID | 66652626 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate |
| SMILES | CC(=O)OC1CC(c2ccncc2[N+](=O)[O-])OC2(CC2)C1 |
| InChI | InChI=1S/C14H16N2O5/c1-9(17)20-10-6-13(21-14(7-10)3-4-14)11-2-5-15-8-12(11)16(18)19/h2,5,8,10,13H,3-4,6-7H2,1H3 |
| InChIKey | LUKNADIEOAJXQE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|