C10H12N2O5 — CID 123522109
6-(3-nitro-4-pyridinyl)oxane-3,4-diol (PubChem CID 123522109) has the molecular formula C10H12N2O5 and a molecular weight of 240.22 g/mol. Its IUPAC name is 6-(3-nitro-4-pyridinyl)oxane-3,4-diol.
| Compound Name | 6-(3-nitro-4-pyridinyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 123522109 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 6-(3-nitro-4-pyridinyl)oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1cnccc1C1CC(O)C(O)CO1 |
| InChI | InChI=1S/C10H12N2O5/c13-8-3-10(17-5-9(8)14)6-1-2-11-4-7(6)12(15)16/h1-2,4,8-10,13-14H,3,5H2 |
| InChIKey | SQCFPJFPJNKJNK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|