C10H12N2O5 — CID 66652542
[(2R,4R)-2-(3-nitro-4-pyridinyl)-1,3-dioxan-4-yl]methanol (PubChem CID 66652542) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is [(2R,4R)-2-(3-nitro-4-pyridinyl)-1,3-dioxan-4-yl]methanol.
| Compound Name | [(2R,4R)-2-(3-nitro-4-pyridinyl)-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 66652542 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | [(2R,4R)-2-(3-nitro-4-pyridinyl)-1,3-dioxan-4-yl]methanol |
| SMILES | O=[N+]([O-])c1cnccc1[C@@H]1OCC[C@H](CO)O1 |
| InChI | InChI=1S/C10H12N2O5/c13-6-7-2-4-16-10(17-7)8-1-3-11-5-9(8)12(14)15/h1,3,5,7,10,13H,2,4,6H2/t7-,10-/m1/s1 |
| InChIKey | BUTKVODNELVHFJ-GMSGAONNSA-N |
| XLogP | 0.79 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|