C28H40N4O6 — CID 162194409
3-nitro-4-[(2R,3S,4S,5R,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine;3-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine (PubChem CID 162194409) has the molecular formula C28H40N4O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is 3-nitro-4-[(2R,3S,4S,5R,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine;3-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine.
| Compound Name | 3-nitro-4-[(2R,3S,4S,5R,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine;3-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine |
|---|---|
| PubChem CID | 162194409 |
| Molecular Formula | C28H40N4O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | 3-nitro-4-[(2R,3S,4S,5R,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine;3-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5,6-tetramethyloxan-2-yl]pyridine |
| SMILES | C[C@H]1[C@@H](C)[C@@H](C)O[C@@H](c2ccncc2[N+](=O)[O-])[C@H]1C.C[C@H]1[C@H](C)[C@@H](C)O[C@@H](c2ccncc2[N+](=O)[O-])[C@H]1C |
| InChI | InChI=1S/2C14H20N2O3/c2*1-8-9(2)11(4)19-14(10(8)3)12-5-6-15-7-13(12)16(17)18/h2*5-11,14H,1-4H3/t8-,9+,10-,11+,14+;8-,9-,10-,11+,14+/m00/s1 |
| InChIKey | ZQTCLFCFDZMCBJ-XYAHPZPJSA-N |
| XLogP | 6.72 |
| TPSA | 130.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|