About 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine
4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine (PubChem CID 87745498) has the molecular formula C9H12N3O2+
and a molecular weight of 194.21 g/mol. Its IUPAC name is 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine.
Molecular Properties
| Compound Name | 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine |
| PubChem CID | 87745498 |
| Molecular Formula | C9H12N3O2+ |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine |
| SMILES | C[N+]1(C)CC1c1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N3O2/c1-12(2)6-9(12)7-3-4-10-5-8(7)11(13)14/h3-5,9H,6H2,1-2H3/q+1 |
| InChIKey | HXEQCWXGTHVNAE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine?
The IUPAC name of 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine (CID 87745498) is 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine.
What is the SMILES notation for 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine?
The canonical SMILES for 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine is C[N+]1(C)CC1c1ccncc1[N+](=O)[O-].
What is the InChIKey of 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine?
The InChIKey is HXEQCWXGTHVNAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N3O2/c1-12(2)6-9(12)7-3-4-10-5-8(7)11(13)14/h3-5,9H,6H2,1-2H3/q+1.
What are the key properties of 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine?
4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine has a molecular weight of 194.21 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine is sourced from PubChem (CID 87745498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).