C9H12N3O2+ — CID 87745498
4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine (PubChem CID 87745498) has the molecular formula C9H12N3O2+ and a molecular weight of 194.21 g/mol. Its IUPAC name is 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine.
| Compound Name | 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine |
|---|---|
| PubChem CID | 87745498 |
| Molecular Formula | C9H12N3O2+ |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-(1,1-dimethylaziridin-1-ium-2-yl)-3-nitropyridine |
| SMILES | C[N+]1(C)CC1c1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N3O2/c1-12(2)6-9(12)7-3-4-10-5-8(7)11(13)14/h3-5,9H,6H2,1-2H3/q+1 |
| InChIKey | HXEQCWXGTHVNAE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|