C19H32N2O5Si — CID 131740657
4-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-methyl-6-(3-nitro-4-pyridinyl)oxan-3-ol (PubChem CID 131740657) has the molecular formula C19H32N2O5Si and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-methyl-6-(3-nitro-4-pyridinyl)oxan-3-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-methyl-6-(3-nitro-4-pyridinyl)oxan-3-ol |
|---|---|
| PubChem CID | 131740657 |
| Molecular Formula | C19H32N2O5Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-methyl-6-(3-nitro-4-pyridinyl)oxan-3-ol |
| SMILES | CCC1(O)C(C)OC(c2ccncc2[N+](=O)[O-])CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32N2O5Si/c1-8-19(22)13(2)25-16(14-9-10-20-12-15(14)21(23)24)11-17(19)26-27(6,7)18(3,4)5/h9-10,12-13,16-17,22H,8,11H2,1-7H3 |
| InChIKey | GRZCLEDMZRNFDW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|