C17H28N4O5Si — CID 69043143
[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid (PubChem CID 69043143) has the molecular formula C17H28N4O5Si and a molecular weight of 396.52 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69043143 |
| Molecular Formula | C17H28N4O5Si |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(NC(=O)O)CN(c2ccncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H28N4O5Si/c1-17(2,3)27(4,5)26-13-8-12(19-16(22)23)10-20(11-13)14-6-7-18-9-15(14)21(24)25/h6-7,9,12-13,19H,8,10-11H2,1-5H3,(H,22,23) |
| InChIKey | LUHHFEYHNXZLMD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|