C15H21FN4O4 — CID 67500384
tert-butyl-[(3S,5R)-5-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid (PubChem CID 67500384) has the molecular formula C15H21FN4O4 and a molecular weight of 340.36 g/mol. Its IUPAC name is tert-butyl-[(3S,5R)-5-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S,5R)-5-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67500384 |
| Molecular Formula | C15H21FN4O4 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl-[(3S,5R)-5-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1C[C@@H](F)CN(c2ccncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H21FN4O4/c1-15(2,3)19(14(21)22)11-6-10(16)8-18(9-11)12-4-5-17-7-13(12)20(23)24/h4-5,7,10-11H,6,8-9H2,1-3H3,(H,21,22)/t10-,11+/m1/s1 |
| InChIKey | JRJMJGOWCQDHID-MNOVXSKESA-N |
| XLogP | 2.69 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|