C12H13F3N4O4 — CID 90281012
[1-(3-nitro-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl] carbamate (PubChem CID 90281012) has the molecular formula C12H13F3N4O4 and a molecular weight of 334.25 g/mol. Its IUPAC name is [1-(3-nitro-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl] carbamate.
| Compound Name | [1-(3-nitro-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 90281012 |
| Molecular Formula | C12H13F3N4O4 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [1-(3-nitro-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CC(C(F)(F)F)CN(c2ccncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H13F3N4O4/c13-12(14,15)7-3-8(23-11(16)20)6-18(5-7)9-1-2-17-4-10(9)19(21)22/h1-2,4,7-8H,3,5-6H2,(H2,16,20) |
| InChIKey | LTAXXFRRRZDWNS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|