C10H10N4O4 — CID 168698038
1-(3-nitro-4-pyridinyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168698038) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1-(3-nitro-4-pyridinyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-nitro-4-pyridinyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168698038 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1-(3-nitro-4-pyridinyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2ccncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C10H10N4O4/c11-10(16)6-3-9(15)13(5-6)7-1-2-12-4-8(7)14(17)18/h1-2,4,6H,3,5H2,(H2,11,16) |
| InChIKey | AQLMIAOLNNOQHV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|