C11H10F3N3O2 — CID 168698147
5-oxo-1-[4-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide (PubChem CID 168698147) has the molecular formula C11H10F3N3O2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 5-oxo-1-[4-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-[4-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168698147 |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-oxo-1-[4-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2cnccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C11H10F3N3O2/c12-11(13,14)7-1-2-16-4-8(7)17-5-6(10(15)19)3-9(17)18/h1-2,4,6H,3,5H2,(H2,15,19) |
| InChIKey | GVTLGOLUTUXQRY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |