C12H10ClF3N2O2 — CID 168697516
1-[2-chloro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 168697516) has the molecular formula C12H10ClF3N2O2 and a molecular weight of 306.67 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697516 |
| Molecular Formula | C12H10ClF3N2O2 |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2c(Cl)cccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10ClF3N2O2/c13-8-3-1-2-7(12(14,15)16)10(8)18-5-6(11(17)20)4-9(18)19/h1-3,6H,4-5H2,(H2,17,20) |
| InChIKey | UXPUPNWEQCOSRO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |