C11H9F2N3O4 — CID 168697603
1-(2,6-difluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168697603) has the molecular formula C11H9F2N3O4 and a molecular weight of 285.21 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,6-difluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697603 |
| Molecular Formula | C11H9F2N3O4 |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(2,6-difluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2c(F)ccc([N+](=O)[O-])c2F)C1 |
| InChI | InChI=1S/C11H9F2N3O4/c12-6-1-2-7(16(19)20)9(13)10(6)15-4-5(11(14)18)3-8(15)17/h1-2,5H,3-4H2,(H2,14,18) |
| InChIKey | WXXUHKBQQTVQGL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|