C19H32N4O5Si — CID 90279704
[(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(3-methyl-5-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid (PubChem CID 90279704) has the molecular formula C19H32N4O5Si and a molecular weight of 424.57 g/mol. Its IUPAC name is [(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(3-methyl-5-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid.
| Compound Name | [(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(3-methyl-5-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 90279704 |
| Molecular Formula | C19H32N4O5Si |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(3-methyl-5-nitro-4-pyridinyl)piperidin-3-yl]carbamic acid |
| SMILES | Cc1cncc([N+](=O)[O-])c1N1C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](NC(=O)O)C1 |
| InChI | InChI=1S/C19H32N4O5Si/c1-12-8-20-9-15(23(26)27)16(12)22-10-13(2)17(14(11-22)21-18(24)25)28-29(6,7)19(3,4)5/h8-9,13-14,17,21H,10-11H2,1-7H3,(H,24,25)/t13-,14+,17+/m0/s1 |
| InChIKey | QWUCZQMBMROHCL-JJRVBVJISA-N |
| XLogP | 3.78 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|