C19H25F3N4O4 — CID 86726741
tert-butyl N-[(3S,5R)-1-(3-nitro-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate (PubChem CID 86726741) has the molecular formula C19H25F3N4O4 and a molecular weight of 430.43 g/mol. Its IUPAC name is tert-butyl N-[(3S,5R)-1-(3-nitro-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5R)-1-(3-nitro-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86726741 |
| Molecular Formula | C19H25F3N4O4 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | tert-butyl N-[(3S,5R)-1-(3-nitro-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](C(F)(F)F)CN(c2c([N+](=O)[O-])cnc3c2CCC3)C1 |
| InChI | InChI=1S/C19H25F3N4O4/c1-18(2,3)30-17(27)24-12-7-11(19(20,21)22)9-25(10-12)16-13-5-4-6-14(13)23-8-15(16)26(28)29/h8,11-12H,4-7,9-10H2,1-3H3,(H,24,27)/t11-,12+/m1/s1 |
| InChIKey | ICCIPLASKZBNEQ-NEPJUHHUSA-N |
| XLogP | 3.76 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|