C18H30N4O5Si — CID 68563141
[(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylpiperidin-3-yl]-(3-nitro-4-pyridinyl)carbamic acid (PubChem CID 68563141) has the molecular formula C18H30N4O5Si and a molecular weight of 410.55 g/mol. Its IUPAC name is [(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylpiperidin-3-yl]-(3-nitro-4-pyridinyl)carbamic acid.
| Compound Name | [(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylpiperidin-3-yl]-(3-nitro-4-pyridinyl)carbamic acid |
|---|---|
| PubChem CID | 68563141 |
| Molecular Formula | C18H30N4O5Si |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [(3R,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylpiperidin-3-yl]-(3-nitro-4-pyridinyl)carbamic acid |
| SMILES | C[C@H]1CNC[C@@H](N(C(=O)O)c2ccncc2[N+](=O)[O-])[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30N4O5Si/c1-12-9-20-11-15(16(12)27-28(5,6)18(2,3)4)21(17(23)24)13-7-8-19-10-14(13)22(25)26/h7-8,10,12,15-16,20H,9,11H2,1-6H3,(H,23,24)/t12-,15+,16+/m0/s1 |
| InChIKey | UWLINQYBNZUODQ-APHBMKBZSA-N |
| XLogP | 3.47 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|