C21H36N4O5Si — CID 67130201
tert-butyl N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-N-(3-nitro-4-pyridinyl)carbamate (PubChem CID 67130201) has the molecular formula C21H36N4O5Si and a molecular weight of 452.63 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-N-(3-nitro-4-pyridinyl)carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-N-(3-nitro-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 67130201 |
| Molecular Formula | C21H36N4O5Si |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | tert-butyl N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-N-(3-nitro-4-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccncc1[N+](=O)[O-])[C@@H]1CNCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36N4O5Si/c1-20(2,3)29-19(26)24(15-9-11-22-13-16(15)25(27)28)17-14-23-12-10-18(17)30-31(7,8)21(4,5)6/h9,11,13,17-18,23H,10,12,14H2,1-8H3/t17-,18-/m1/s1 |
| InChIKey | YKJJUAULUOZQDG-QZTJIDSGSA-N |
| XLogP | 4.48 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|