C22H35N3O5Si — CID 59455770
tert-butyl N-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-(3-nitro-4-pyridinyl)cyclohex-2-en-1-yl]carbamate (PubChem CID 59455770) has the molecular formula C22H35N3O5Si and a molecular weight of 449.62 g/mol. Its IUPAC name is tert-butyl N-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-(3-nitro-4-pyridinyl)cyclohex-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-(3-nitro-4-pyridinyl)cyclohex-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 59455770 |
| Molecular Formula | C22H35N3O5Si |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | tert-butyl N-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-(3-nitro-4-pyridinyl)cyclohex-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C=C(c2ccncc2[N+](=O)[O-])CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35N3O5Si/c1-21(2,3)29-20(26)24-17-13-15(16-11-12-23-14-18(16)25(27)28)9-10-19(17)30-31(7,8)22(4,5)6/h11-14,17,19H,9-10H2,1-8H3,(H,24,26)/t17-,19-/m1/s1 |
| InChIKey | SDTKIPICLPLRHP-IEBWSBKVSA-N |
| XLogP | 5.45 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|