C21H38N4O3Si — CID 77419825
tert-butyl N-[1-(3-amino-4-pyridinyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate (PubChem CID 77419825) has the molecular formula C21H38N4O3Si and a molecular weight of 422.65 g/mol. Its IUPAC name is tert-butyl N-[1-(3-amino-4-pyridinyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-amino-4-pyridinyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 77419825 |
| Molecular Formula | C21H38N4O3Si |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | tert-butyl N-[1-(3-amino-4-pyridinyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccncc2N)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38N4O3Si/c1-20(2,3)27-19(26)24-16-10-12-25(17-9-11-23-13-15(17)22)14-18(16)28-29(7,8)21(4,5)6/h9,11,13,16,18H,10,12,14,22H2,1-8H3,(H,24,26) |
| InChIKey | DXMDKVSXAXQCMY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|