C17H28AsN3O3Si — CID 87527361
CID 87527361 (PubChem CID 87527361) has the molecular formula C17H28AsN3O3Si and a molecular weight of 425.44 g/mol.
| Compound Name | CID 87527361 |
|---|---|
| PubChem CID | 87527361 |
| Molecular Formula | C17H28AsN3O3Si |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCN(c2ccncc2[As])C[C@H]1NC(=O)O |
| InChI | InChI=1S/C17H28AsN3O3Si/c1-17(2,3)25(4,5)24-15-7-9-21(11-13(15)20-16(22)23)14-6-8-19-10-12(14)18/h6,8,10,13,15,20H,7,9,11H2,1-5H3,(H,22,23)/t13-,15-/m1/s1 |
| InChIKey | QLXNOZUWGAWPIY-UKRRQHHQSA-N |
| XLogP | 2.11 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|