C22H37N3O3Si — CID 146034032
tert-butyl N-[(1S,6S)-3-(3-amino-4-pyridinyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]carbamate (PubChem CID 146034032) has the molecular formula C22H37N3O3Si and a molecular weight of 419.64 g/mol. Its IUPAC name is tert-butyl N-[(1S,6S)-3-(3-amino-4-pyridinyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,6S)-3-(3-amino-4-pyridinyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 146034032 |
| Molecular Formula | C22H37N3O3Si |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | tert-butyl N-[(1S,6S)-3-(3-amino-4-pyridinyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C=C(c2ccncc2N)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37N3O3Si/c1-21(2,3)27-20(26)25-18-13-15(16-11-12-24-14-17(16)23)9-10-19(18)28-29(7,8)22(4,5)6/h11-14,18-19H,9-10,23H2,1-8H3,(H,25,26)/t18-,19-/m0/s1 |
| InChIKey | OURDRLUIMBWCOK-OALUTQOASA-N |
| XLogP | 5.12 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|