C18H27N3O3 — CID 86682518
tert-butyl N-[(2S,4S,4aS,7aS)-2-(3-amino-4-pyridinyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate (PubChem CID 86682518) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl N-[(2S,4S,4aS,7aS)-2-(3-amino-4-pyridinyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4S,4aS,7aS)-2-(3-amino-4-pyridinyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate |
|---|---|
| PubChem CID | 86682518 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | tert-butyl N-[(2S,4S,4aS,7aS)-2-(3-amino-4-pyridinyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](c2ccncc2N)O[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C18H27N3O3/c1-18(2,3)24-17(22)21-14-9-16(11-7-8-20-10-13(11)19)23-15-6-4-5-12(14)15/h7-8,10,12,14-16H,4-6,9,19H2,1-3H3,(H,21,22)/t12-,14-,15-,16-/m0/s1 |
| InChIKey | QDRQNFREJJWLAR-TUUVXOQKSA-N |
| XLogP | 3.19 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |