C13H23NO3 — CID 160939669
tert-butyl N-[(4S,4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate (PubChem CID 160939669) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl N-[(4S,4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate |
|---|---|
| PubChem CID | 160939669 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl N-[(4S,4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCO[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C13H23NO3/c1-13(2,3)17-12(15)14-10-7-8-16-11-6-4-5-9(10)11/h9-11H,4-8H2,1-3H3,(H,14,15)/t9-,10-,11-/m0/s1 |
| InChIKey | KBVXXRVDDORGRB-DCAQKATOSA-N |
| XLogP | 2.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |