C10H18BF3NO2- — CID 82017749
trifluoro-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]boranuide (PubChem CID 82017749) has the molecular formula C10H18BF3NO2- and a molecular weight of 252.06 g/mol. Its IUPAC name is trifluoro-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]boranuide.
| Compound Name | trifluoro-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]boranuide |
|---|---|
| PubChem CID | 82017749 |
| Molecular Formula | C10H18BF3NO2- |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | trifluoro-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]boranuide |
| SMILES | CC(C)(C)OC(=O)NC1CCCC1[B-](F)(F)F |
| InChI | InChI=1S/C10H18BF3NO2/c1-10(2,3)17-9(16)15-8-6-4-5-7(8)11(12,13)14/h7-8H,4-6H2,1-3H3,(H,15,16)/q-1 |
| InChIKey | PTWQCBAQYQGULD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|