C17H27N3O4 — CID 77241045
tert-butyl N-[6-(3-amino-4-pyridinyl)-2-ethyl-3-hydroxyoxan-4-yl]carbamate (PubChem CID 77241045) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl N-[6-(3-amino-4-pyridinyl)-2-ethyl-3-hydroxyoxan-4-yl]carbamate.
| Compound Name | tert-butyl N-[6-(3-amino-4-pyridinyl)-2-ethyl-3-hydroxyoxan-4-yl]carbamate |
|---|---|
| PubChem CID | 77241045 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl N-[6-(3-amino-4-pyridinyl)-2-ethyl-3-hydroxyoxan-4-yl]carbamate |
| SMILES | CCC1OC(c2ccncc2N)CC(NC(=O)OC(C)(C)C)C1O |
| InChI | InChI=1S/C17H27N3O4/c1-5-13-15(21)12(20-16(22)24-17(2,3)4)8-14(23-13)10-6-7-19-9-11(10)18/h6-7,9,12-15,21H,5,8,18H2,1-4H3,(H,20,22) |
| InChIKey | LYNRLCAJTDESMW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |