C17H30N4O2 — CID 143755854
tert-butyl N-[1-(3-amino-4-pyridinyl)piperidin-4-yl]carbamate;ethane (PubChem CID 143755854) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[1-(3-amino-4-pyridinyl)piperidin-4-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-(3-amino-4-pyridinyl)piperidin-4-yl]carbamate;ethane |
|---|---|
| PubChem CID | 143755854 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | tert-butyl N-[1-(3-amino-4-pyridinyl)piperidin-4-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC1CCN(c2ccncc2N)CC1 |
| InChI | InChI=1S/C15H24N4O2.C2H6/c1-15(2,3)21-14(20)18-11-5-8-19(9-6-11)13-4-7-17-10-12(13)16;1-2/h4,7,10-11H,5-6,8-9,16H2,1-3H3,(H,18,20);1-2H3 |
| InChIKey | KQJQCXVWZAXGMR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |