C16H28N4O2 — CID 160643676
tert-butyl (2R)-4-(3-amino-4-pyridinyl)-2-methylpiperazine-1-carboxylate;methane (PubChem CID 160643676) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl (2R)-4-(3-amino-4-pyridinyl)-2-methylpiperazine-1-carboxylate;methane.
| Compound Name | tert-butyl (2R)-4-(3-amino-4-pyridinyl)-2-methylpiperazine-1-carboxylate;methane |
|---|---|
| PubChem CID | 160643676 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl (2R)-4-(3-amino-4-pyridinyl)-2-methylpiperazine-1-carboxylate;methane |
| SMILES | C.C[C@@H]1CN(c2ccncc2N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N4O2.CH4/c1-11-10-18(13-5-6-17-9-12(13)16)7-8-19(11)14(20)21-15(2,3)4;/h5-6,9,11H,7-8,10,16H2,1-4H3;1H4/t11-;/m1./s1 |
| InChIKey | RJMWXAZHDDPPRV-RFVHGSKJSA-N |
| XLogP | 2.75 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |