C15H23IN4O2 — CID 89152155
tert-butyl N-[(3S,5R)-1-(3-amino-4-pyridinyl)-5-iodopiperidin-3-yl]carbamate (PubChem CID 89152155) has the molecular formula C15H23IN4O2 and a molecular weight of 418.28 g/mol. Its IUPAC name is tert-butyl N-[(3S,5R)-1-(3-amino-4-pyridinyl)-5-iodopiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5R)-1-(3-amino-4-pyridinyl)-5-iodopiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 89152155 |
| Molecular Formula | C15H23IN4O2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | tert-butyl N-[(3S,5R)-1-(3-amino-4-pyridinyl)-5-iodopiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](I)CN(c2ccncc2N)C1 |
| InChI | InChI=1S/C15H23IN4O2/c1-15(2,3)22-14(21)19-11-6-10(16)8-20(9-11)13-4-5-18-7-12(13)17/h4-5,7,10-11H,6,8-9,17H2,1-3H3,(H,19,21)/t10-,11+/m1/s1 |
| InChIKey | GTXMWKMRFJBPRS-MNOVXSKESA-N |
| XLogP | 2.57 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|