C19H29N3O4 — CID 77241039
tert-butyl N-[6-(3-amino-4-pyridinyl)-2-cyclopropyl-3-hydroxy-3-methyloxan-4-yl]carbamate (PubChem CID 77241039) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl N-[6-(3-amino-4-pyridinyl)-2-cyclopropyl-3-hydroxy-3-methyloxan-4-yl]carbamate.
| Compound Name | tert-butyl N-[6-(3-amino-4-pyridinyl)-2-cyclopropyl-3-hydroxy-3-methyloxan-4-yl]carbamate |
|---|---|
| PubChem CID | 77241039 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl N-[6-(3-amino-4-pyridinyl)-2-cyclopropyl-3-hydroxy-3-methyloxan-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(c2ccncc2N)OC(C2CC2)C1(C)O |
| InChI | InChI=1S/C19H29N3O4/c1-18(2,3)26-17(23)22-15-9-14(12-7-8-21-10-13(12)20)25-16(11-5-6-11)19(15,4)24/h7-8,10-11,14-16,24H,5-6,9,20H2,1-4H3,(H,22,23) |
| InChIKey | QMBWIDQCHZPSPG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |