C28H32F2N6O5 — CID 67208140
tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-(6-amino-2-fluoro-3-pyridinyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate (PubChem CID 67208140) has the molecular formula C28H32F2N6O5 and a molecular weight of 570.60 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-(6-amino-2-fluoro-3-pyridinyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-(6-amino-2-fluoro-3-pyridinyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate |
|---|---|
| PubChem CID | 67208140 |
| Molecular Formula | C28H32F2N6O5 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-(6-amino-2-fluoro-3-pyridinyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate |
| SMILES | C[C@H]1O[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3ccc(N)nc3F)n2)C[C@@H](NC(=O)OC(C)(C)C)[C@]1(C)O |
| InChI | InChI=1S/C28H32F2N6O5/c1-14-28(5,39)21(35-26(38)41-27(2,3)4)12-20(40-14)15-10-11-32-13-19(15)34-25(37)18-8-7-17(29)23(33-18)16-6-9-22(31)36-24(16)30/h6-11,13-14,20-21,39H,12H2,1-5H3,(H2,31,36)(H,34,37)(H,35,38)/t14-,20-,21-,28-/m1/s1 |
| InChIKey | IFGHBORYPJZACL-PYVBKIJMSA-N |
| XLogP | 4.15 |
| TPSA | 161.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|