C26H24F2N4O3 — CID 66554863
6-(4-cyano-2-fluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 66554863) has the molecular formula C26H24F2N4O3 and a molecular weight of 478.50 g/mol. Its IUPAC name is 6-(4-cyano-2-fluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-(4-cyano-2-fluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 66554863 |
| Molecular Formula | C26H24F2N4O3 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 6-(4-cyano-2-fluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3ccc(C#N)cc3F)n2)C[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C26H24F2N4O3/c1-14-9-16(11-23(33)26(14,2)35)17-7-8-30-13-22(17)32-25(34)21-6-5-19(27)24(31-21)18-4-3-15(12-29)10-20(18)28/h3-8,10,13-14,16,23,33,35H,9,11H2,1-2H3,(H,32,34)/t14-,16+,23+,26+/m0/s1 |
| InChIKey | VGRCQEVZVXACDL-PGAXMMRYSA-N |
| XLogP | 4.17 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |