C27H26F3N3O5 — CID 90330457
2-[(1S,2R,4R,6S)-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-1,2-dihydroxy-6-methylcyclohexyl]propanoic acid (PubChem CID 90330457) has the molecular formula C27H26F3N3O5 and a molecular weight of 529.52 g/mol. Its IUPAC name is 2-[(1S,2R,4R,6S)-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-1,2-dihydroxy-6-methylcyclohexyl]propanoic acid.
| Compound Name | 2-[(1S,2R,4R,6S)-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-1,2-dihydroxy-6-methylcyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 90330457 |
| Molecular Formula | C27H26F3N3O5 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 2-[(1S,2R,4R,6S)-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-1,2-dihydroxy-6-methylcyclohexyl]propanoic acid |
| SMILES | CC(C(=O)O)[C@]1(O)[C@H](O)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C27H26F3N3O5/c1-13-10-15(11-22(34)27(13,38)14(2)26(36)37)16-8-9-31-12-21(16)33-25(35)20-7-6-19(30)24(32-20)23-17(28)4-3-5-18(23)29/h3-9,12-15,22,34,38H,10-11H2,1-2H3,(H,33,35)(H,36,37)/t13-,14?,15+,22+,27-/m0/s1 |
| InChIKey | RADBCWCIYTXZGW-ISKLBGTFSA-N |
| XLogP | 4.14 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |