C28H28F3N3O5 — CID 70660752
6-[2,6-difluoro-4-(3-hydroxyoxetan-3-yl)phenyl]-N-[4-[(1S,3S,4S,5R)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 70660752) has the molecular formula C28H28F3N3O5 and a molecular weight of 543.54 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(3-hydroxyoxetan-3-yl)phenyl]-N-[4-[(1S,3S,4S,5R)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-[2,6-difluoro-4-(3-hydroxyoxetan-3-yl)phenyl]-N-[4-[(1S,3S,4S,5R)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70660752 |
| Molecular Formula | C28H28F3N3O5 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 6-[2,6-difluoro-4-(3-hydroxyoxetan-3-yl)phenyl]-N-[4-[(1S,3S,4S,5R)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@@H]1C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C4(O)COC4)cc3F)n2)C[C@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C28H28F3N3O5/c1-14-7-15(8-23(35)27(14,2)37)17-5-6-32-11-22(17)34-26(36)21-4-3-18(29)25(33-21)24-19(30)9-16(10-20(24)31)28(38)12-39-13-28/h3-6,9-11,14-15,23,35,37-38H,7-8,12-13H2,1-2H3,(H,34,36)/t14-,15+,23+,27+/m1/s1 |
| InChIKey | RXXQSBLNYBHJJG-MHXXTIGSSA-N |
| XLogP | 3.66 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |