C27H29F3N4O2 — CID 66556729
N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(4-ethyl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 66556729) has the molecular formula C27H29F3N4O2 and a molecular weight of 498.55 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(4-ethyl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(4-ethyl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 66556729 |
| Molecular Formula | C27H29F3N4O2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(4-ethyl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | CCc1cc(F)c(-c2nc(C(=O)Nc3cnccc3[C@H]3C[C@@H](N)[C@](C)(O)[C@@H](C)C3)ccc2F)c(F)c1 |
| InChI | InChI=1S/C27H29F3N4O2/c1-4-15-10-19(29)24(20(30)11-15)25-18(28)5-6-21(33-25)26(35)34-22-13-32-8-7-17(22)16-9-14(2)27(3,36)23(31)12-16/h5-8,10-11,13-14,16,23,36H,4,9,12,31H2,1-3H3,(H,34,35)/t14-,16+,23+,27+/m0/s1 |
| InChIKey | FANYPFKFBSHXBF-PLGAHTHOSA-N |
| XLogP | 4.97 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |