C30H31F3N4O2 — CID 70655697
N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(3-cyclopent-2-en-1-yl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 70655697) has the molecular formula C30H31F3N4O2 and a molecular weight of 536.60 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(3-cyclopent-2-en-1-yl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(3-cyclopent-2-en-1-yl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70655697 |
| Molecular Formula | C30H31F3N4O2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(3-cyclopent-2-en-1-yl-2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)ccc(C4C=CCC4)c3F)n2)C[C@@H](N)[C@]1(C)O |
| InChI | InChI=1S/C30H31F3N4O2/c1-16-13-18(14-25(34)30(16,2)39)19-11-12-35-15-24(19)37-29(38)23-10-9-22(32)28(36-23)26-21(31)8-7-20(27(26)33)17-5-3-4-6-17/h3,5,7-12,15-18,25,39H,4,6,13-14,34H2,1-2H3,(H,37,38)/t16-,17?,18+,25+,30+/m0/s1 |
| InChIKey | MBDVWOOSEFUHMT-WCJILZCBSA-N |
| XLogP | 5.84 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|