C29H31F3N4O3 — CID 70655923
N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 70655923) has the molecular formula C29H31F3N4O3 and a molecular weight of 540.59 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70655923 |
| Molecular Formula | C29H31F3N4O3 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C4(O)CCC4)cc3F)n2)C[C@@H](N)[C@]1(C)O |
| InChI | InChI=1S/C29H31F3N4O3/c1-15-10-16(11-24(33)28(15,2)38)18-6-9-34-14-23(18)36-27(37)22-5-4-19(30)26(35-22)25-20(31)12-17(13-21(25)32)29(39)7-3-8-29/h4-6,9,12-16,24,38-39H,3,7-8,10-11,33H2,1-2H3,(H,36,37)/t15-,16+,24+,28+/m0/s1 |
| InChIKey | ZTVQULWACKTNHJ-DEFIUKHDSA-N |
| XLogP | 4.78 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |