C29H33F3N4O3 — CID 66555377
N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(propan-2-yloxymethyl)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 66555377) has the molecular formula C29H33F3N4O3 and a molecular weight of 542.60 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(propan-2-yloxymethyl)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(propan-2-yloxymethyl)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 66555377 |
| Molecular Formula | C29H33F3N4O3 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(propan-2-yloxymethyl)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CC(C)OCc1cc(F)c(-c2nc(C(=O)Nc3cnccc3[C@H]3C[C@@H](N)[C@](C)(O)[C@@H](C)C3)ccc2F)c(F)c1 |
| InChI | InChI=1S/C29H33F3N4O3/c1-15(2)39-14-17-10-21(31)26(22(32)11-17)27-20(30)5-6-23(35-27)28(37)36-24-13-34-8-7-19(24)18-9-16(3)29(4,38)25(33)12-18/h5-8,10-11,13,15-16,18,25,38H,9,12,14,33H2,1-4H3,(H,36,37)/t16-,18+,25+,29+/m0/s1 |
| InChIKey | VGSXAGRKBJTKNH-UDGIOSAHSA-N |
| XLogP | 5.33 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |