C28H29F3N4O4 — CID 70655383
N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 70655383) has the molecular formula C28H29F3N4O4 and a molecular weight of 542.56 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70655383 |
| Molecular Formula | C28H29F3N4O4 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(3-methoxyoxetan-3-yl)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | COC1(c2cc(F)c(-c3nc(C(=O)Nc4cnccc4[C@H]4C[C@@H](N)[C@H](O)[C@@H](C)C4)ccc3F)c(F)c2)COC1 |
| InChI | InChI=1S/C28H29F3N4O4/c1-14-7-15(8-21(32)26(14)36)17-5-6-33-11-23(17)35-27(37)22-4-3-18(29)25(34-22)24-19(30)9-16(10-20(24)31)28(38-2)12-39-13-28/h3-6,9-11,14-15,21,26,36H,7-8,12-13,32H2,1-2H3,(H,35,37)/t14-,15+,21+,26+/m0/s1 |
| InChIKey | WJCURLALBFWSQP-IVOKJWQASA-N |
| XLogP | 3.89 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |