C26H27F3N4O — CID 70907941
N-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-3-methylphenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 70907941) has the molecular formula C26H27F3N4O and a molecular weight of 468.52 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-3-methylphenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-3-methylphenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70907941 |
| Molecular Formula | C26H27F3N4O |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-3-methylphenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | Cc1ccc(F)c(-c2nc(C(=O)Nc3cnccc3[C@H]3C[C@@H](N)[C@@H](C)[C@@H](C)C3)ccc2F)c1F |
| InChI | InChI=1S/C26H27F3N4O/c1-13-4-5-18(27)23(24(13)29)25-19(28)6-7-21(32-25)26(34)33-22-12-31-9-8-17(22)16-10-14(2)15(3)20(30)11-16/h4-9,12,14-16,20H,10-11,30H2,1-3H3,(H,33,34)/t14-,15-,16+,20+/m0/s1 |
| InChIKey | WDCOGCYJSPAJRD-ZFCANOHDSA-N |
| XLogP | 5.60 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |