C27H26F3N5O2 — CID 72549146
N-[4-[(1S,3S,4R,5R)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 72549146) has the molecular formula C27H26F3N5O2 and a molecular weight of 509.53 g/mol. Its IUPAC name is N-[4-[(1S,3S,4R,5R)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1S,3S,4R,5R)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 72549146 |
| Molecular Formula | C27H26F3N5O2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-[4-[(1S,3S,4R,5R)-3-amino-4-(2-cyanoethoxy)-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@@H]1C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@H](N)[C@@H]1OCCC#N |
| InChI | InChI=1S/C27H26F3N5O2/c1-15-12-16(13-21(32)26(15)37-11-3-9-31)17-8-10-33-14-23(17)35-27(36)22-7-6-20(30)25(34-22)24-18(28)4-2-5-19(24)29/h2,4-8,10,14-16,21,26H,3,11-13,32H2,1H3,(H,35,36)/t15-,16+,21+,26-/m1/s1 |
| InChIKey | CHPLSEJPLSDICK-IFRAOVOBSA-N |
| XLogP | 4.95 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|