C27H27F3N4O4 — CID 72550943
3-[(1S,2S,4S,6R)-2-amino-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]oxypropanoic acid (PubChem CID 72550943) has the molecular formula C27H27F3N4O4 and a molecular weight of 528.53 g/mol. Its IUPAC name is 3-[(1S,2S,4S,6R)-2-amino-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]oxypropanoic acid.
| Compound Name | 3-[(1S,2S,4S,6R)-2-amino-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]oxypropanoic acid |
|---|---|
| PubChem CID | 72550943 |
| Molecular Formula | C27H27F3N4O4 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 3-[(1S,2S,4S,6R)-2-amino-4-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-6-methylcyclohexyl]oxypropanoic acid |
| SMILES | C[C@@H]1C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@H](N)[C@H]1OCCC(=O)O |
| InChI | InChI=1S/C27H27F3N4O4/c1-14-11-15(12-20(31)26(14)38-10-8-23(35)36)16-7-9-32-13-22(16)34-27(37)21-6-5-19(30)25(33-21)24-17(28)3-2-4-18(24)29/h2-7,9,13-15,20,26H,8,10-12,31H2,1H3,(H,34,37)(H,35,36)/t14-,15+,20+,26+/m1/s1 |
| InChIKey | XBUJJWKSFWVCRV-HGPMXPCZSA-N |
| XLogP | 4.51 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |